C25H41O9P — CID 156969855
[(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate (PubChem CID 156969855) has the molecular formula C25H41O9P and a molecular weight of 516.57 g/mol. Its IUPAC name is [(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate.
| Compound Name | [(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
|---|---|
| PubChem CID | 156969855 |
| Molecular Formula | C25H41O9P |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | [(2R)-1-acetyloxy-3-phosphonooxypropan-2-yl] (5Z,8Z,10E,12S,14Z)-12-hydroxyicosa-5,8,10,14-tetraenoate |
| SMILES | CCCCC/C=C\C[C@H](O)/C=C/C=C\C/C=C\CCCC(=O)O[C@H](COC(C)=O)COP(=O)(O)O |
| InChI | InChI=1S/C25H41O9P/c1-3-4-5-6-11-14-17-23(27)18-15-12-9-7-8-10-13-16-19-25(28)34-24(20-32-22(2)26)21-33-35(29,30)31/h8-12,14-15,18,23-24,27H,3-7,13,16-17,19-21H2,1-2H3,(H2,29,30,31)/b10-8-,12-9-,14-11-,18-15+/t23-,24+/m0/s1 |
| InChIKey | IEDYPTADLOGIGQ-GPKSNYHTSA-N |
| XLogP | 4.69 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|