C27H28Cl2N2O — CID 15697308
2-(3,4-dichlorophenyl)-N-methyl-N-[(2R,3R)-3-pyrrolidin-1-yl-1,2,3,4-tetrahydroanthracen-2-yl]acetamide (PubChem CID 15697308) has the molecular formula C27H28Cl2N2O and a molecular weight of 467.44 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-methyl-N-[(2R,3R)-3-pyrrolidin-1-yl-1,2,3,4-tetrahydroanthracen-2-yl]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(2R,3R)-3-pyrrolidin-1-yl-1,2,3,4-tetrahydroanthracen-2-yl]acetamide |
|---|---|
| PubChem CID | 15697308 |
| Molecular Formula | C27H28Cl2N2O |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-methyl-N-[(2R,3R)-3-pyrrolidin-1-yl-1,2,3,4-tetrahydroanthracen-2-yl]acetamide |
| SMILES | CN(C(=O)Cc1ccc(Cl)c(Cl)c1)[C@@H]1Cc2cc3ccccc3cc2C[C@H]1N1CCCC1 |
| InChI | InChI=1S/C27H28Cl2N2O/c1-30(27(32)13-18-8-9-23(28)24(29)12-18)25-16-21-14-19-6-2-3-7-20(19)15-22(21)17-26(25)31-10-4-5-11-31/h2-3,6-9,12,14-15,25-26H,4-5,10-11,13,16-17H2,1H3/t25-,26-/m1/s1 |
| InChIKey | QZPVBDWKSMUGSH-CLJLJLNGSA-N |
| XLogP | 5.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |