C41H74NO8P — CID 156988818
[(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate (PubChem CID 156988818) has the molecular formula C41H74NO8P and a molecular weight of 740.02 g/mol. Its IUPAC name is [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate.
| Compound Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 156988818 |
| Molecular Formula | C41H74NO8P |
| Molecular Weight | 740.02 g/mol |
| Exact Mass | 739.52 |
| IUPAC Name | [(2R)-1-[2-aminoethoxy(hydroxy)phosphoryl]oxy-3-[(1E,11Z)-octadeca-1,11-dienoxy]propan-2-yl] (10E,12E,15E)-9-hydroxyoctadeca-10,12,15-trienoate |
| SMILES | CC/C=C/C/C=C/C=C/C(O)CCCCCCCC(=O)O[C@H](CO/C=C/CCCCCCCC/C=C\CCCCCC)COP(=O)(O)OCCN |
| InChI | InChI=1S/C41H74NO8P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-26-30-35-47-37-40(38-49-51(45,46)48-36-34-42)50-41(44)33-29-25-22-24-28-32-39(43)31-27-23-20-10-8-6-4-2/h6,8,12-13,20,23,27,30-31,35,39-40,43H,3-5,7,9-11,14-19,21-22,24-26,28-29,32-34,36-38,42H2,1-2H3,(H,45,46)/b8-6+,13-12-,23-20+,31-27+,35-30+/t39?,40-/m1/s1 |
| InChIKey | KHRCOSWEJXBZJH-DLMQWWIJSA-N |
| XLogP | 10.73 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.02 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|