About ethane;4-methoxy-1,2-oxazole-3-carboxamide
ethane;4-methoxy-1,2-oxazole-3-carboxamide (PubChem CID 157030900) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is ethane;4-methoxy-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | ethane;4-methoxy-1,2-oxazole-3-carboxamide |
| PubChem CID | 157030900 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | ethane;4-methoxy-1,2-oxazole-3-carboxamide |
| SMILES | CC.COc1conc1C(N)=O |
| InChI | InChI=1S/C5H6N2O3.C2H6/c1-9-3-2-10-7-4(3)5(6)8;1-2/h2H,1H3,(H2,6,8);1-2H3 |
| InChIKey | GVDDIOPSUWJZAN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;4-methoxy-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methoxy-1,2-oxazole-3-carboxamide?
The IUPAC name of ethane;4-methoxy-1,2-oxazole-3-carboxamide (CID 157030900) is ethane;4-methoxy-1,2-oxazole-3-carboxamide.
What is the SMILES notation for ethane;4-methoxy-1,2-oxazole-3-carboxamide?
The canonical SMILES for ethane;4-methoxy-1,2-oxazole-3-carboxamide is CC.COc1conc1C(N)=O.
What is the InChIKey of ethane;4-methoxy-1,2-oxazole-3-carboxamide?
The InChIKey is GVDDIOPSUWJZAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3.C2H6/c1-9-3-2-10-7-4(3)5(6)8;1-2/h2H,1H3,(H2,6,8);1-2H3.
What are the key properties of ethane;4-methoxy-1,2-oxazole-3-carboxamide?
ethane;4-methoxy-1,2-oxazole-3-carboxamide has a molecular weight of 172.18 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methoxy-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 157030900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).