C7H8N2O4 — CID 125489980
methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate (PubChem CID 125489980) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 125489980 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate |
| SMILES | CNC(=O)c1nocc1C(=O)OC |
| InChI | InChI=1S/C7H8N2O4/c1-8-6(10)5-4(3-13-9-5)7(11)12-2/h3H,1-2H3,(H,8,10) |
| InChIKey | YEPPLHRPQGVHCF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |