About methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate
methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate (PubChem CID 125489980) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate |
| PubChem CID | 125489980 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate |
| SMILES | CNC(=O)c1nocc1C(=O)OC |
| InChI | InChI=1S/C7H8N2O4/c1-8-6(10)5-4(3-13-9-5)7(11)12-2/h3H,1-2H3,(H,8,10) |
| InChIKey | YEPPLHRPQGVHCF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate?
The IUPAC name of methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate (CID 125489980) is methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate.
What is the SMILES notation for methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate?
The canonical SMILES for methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate is CNC(=O)c1nocc1C(=O)OC.
What is the InChIKey of methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate?
The InChIKey is YEPPLHRPQGVHCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-8-6(10)5-4(3-13-9-5)7(11)12-2/h3H,1-2H3,(H,8,10).
What are the key properties of methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate?
methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate has a molecular weight of 184.15 g/mol, XLogP of -0.18, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(methylcarbamoyl)-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 125489980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).