C15H21NO6 — CID 157039568
(2S,3R,4R,5S)-1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 157039568) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 157039568 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2S,3R,4R,5S)-1-[2-(1,3-benzodioxol-5-yl)ethyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H21NO6/c17-7-10-14(19)15(20)11(18)6-16(10)4-3-9-1-2-12-13(5-9)22-8-21-12/h1-2,5,10-11,14-15,17-20H,3-4,6-8H2/t10-,11-,14+,15+/m0/s1 |
| InChIKey | RKRYZDXYJLVAQA-UOVKNHIHSA-N |
| XLogP | -1.28 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |