C14H20ClN3O2S — CID 157042553
1-[2-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]-N-methylmethanesulfonamide (PubChem CID 157042553) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is 1-[2-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]-N-methylmethanesulfonamide.
| Compound Name | 1-[2-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 157042553 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 1-[2-chloro-3-[2-(dimethylamino)ethyl]-1H-indol-4-yl]-N-methylmethanesulfonamide |
| SMILES | CNS(=O)(=O)Cc1cccc2[nH]c(Cl)c(CCN(C)C)c12 |
| InChI | InChI=1S/C14H20ClN3O2S/c1-16-21(19,20)9-10-5-4-6-12-13(10)11(14(15)17-12)7-8-18(2)3/h4-6,16-17H,7-9H2,1-3H3 |
| InChIKey | REQQSHZLRMFGDQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |