C13H16F2N2O2S — CID 178014897
2-[4-(difluoromethylsulfonyl)-1H-indol-3-yl]-N,N-dimethylethanamine (PubChem CID 178014897) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfonyl)-1H-indol-3-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(difluoromethylsulfonyl)-1H-indol-3-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 178014897 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-[4-(difluoromethylsulfonyl)-1H-indol-3-yl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCc1c[nH]c2cccc(S(=O)(=O)C(F)F)c12 |
| InChI | InChI=1S/C13H16F2N2O2S/c1-17(2)7-6-9-8-16-10-4-3-5-11(12(9)10)20(18,19)13(14)15/h3-5,8,13,16H,6-7H2,1-2H3 |
| InChIKey | SVSJTBXVJAFLBG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |