C30H28N6O — CID 157044103
4-[(6-cyanoquinolin-4-yl)amino]-3-methyl-N-[4-[[(E)-1-methyliminopent-2-en-3-yl]amino]phenyl]benzamide (PubChem CID 157044103) has the molecular formula C30H28N6O and a molecular weight of 488.60 g/mol. Its IUPAC name is 4-[(6-cyanoquinolin-4-yl)amino]-3-methyl-N-[4-[[(E)-1-methyliminopent-2-en-3-yl]amino]phenyl]benzamide.
| Compound Name | 4-[(6-cyanoquinolin-4-yl)amino]-3-methyl-N-[4-[[(E)-1-methyliminopent-2-en-3-yl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 157044103 |
| Molecular Formula | C30H28N6O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-[(6-cyanoquinolin-4-yl)amino]-3-methyl-N-[4-[[(E)-1-methyliminopent-2-en-3-yl]amino]phenyl]benzamide |
| SMILES | CC/C(=C\C=N\C)Nc1ccc(NC(=O)c2ccc(Nc3ccnc4ccc(C#N)cc34)c(C)c2)cc1 |
| InChI | InChI=1S/C30H28N6O/c1-4-23(13-15-32-3)34-24-7-9-25(10-8-24)35-30(37)22-6-12-27(20(2)17-22)36-29-14-16-33-28-11-5-21(19-31)18-26(28)29/h5-18,34H,4H2,1-3H3,(H,33,36)(H,35,37)/b23-13+,32-15+ |
| InChIKey | ZTYKDURKTKJVOU-NELQVORSSA-N |
| XLogP | 6.82 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|