C11H11PS3 — CID 157062836
dimethyl-methylidene-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-λ5-phosphane (PubChem CID 157062836) has the molecular formula C11H11PS3 and a molecular weight of 270.38 g/mol. Its IUPAC name is dimethyl-methylidene-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-λ5-phosphane.
| Compound Name | dimethyl-methylidene-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-λ5-phosphane |
|---|---|
| PubChem CID | 157062836 |
| Molecular Formula | C11H11PS3 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | dimethyl-methylidene-(3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl)-λ5-phosphane |
| SMILES | C=P(C)(C)c1cc2sc3ccsc3c2s1 |
| InChI | InChI=1S/C11H11PS3/c1-12(2,3)9-6-8-11(15-9)10-7(14-8)4-5-13-10/h4-6H,1H2,2-3H3 |
| InChIKey | XXOABKCQLZBBIK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|