C24H19Cl2FN4O3 — CID 157066880
2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxybenzamide (PubChem CID 157066880) has the molecular formula C24H19Cl2FN4O3 and a molecular weight of 501.35 g/mol. Its IUPAC name is 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxybenzamide.
| Compound Name | 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxybenzamide |
|---|---|
| PubChem CID | 157066880 |
| Molecular Formula | C24H19Cl2FN4O3 |
| Molecular Weight | 501.35 g/mol |
| Exact Mass | 500.08 |
| IUPAC Name | 2-[2-[4-(aziridine-1-carboximidoyl)-2-fluorophenyl]-2-oxoethyl]-5-chloro-N-(5-chloro-2-pyridinyl)-3-methoxybenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Cc2c(OC)cc(Cl)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N1CC1 |
| InChI | InChI=1S/C24H19Cl2FN4O3/c1-34-21-10-15(26)9-18(24(33)30-22-5-3-14(25)12-29-22)17(21)11-20(32)16-4-2-13(8-19(16)27)23(28)31-6-7-31/h2-5,8-10,12,28H,6-7,11H2,1H3,(H,29,30,33)/b28-23- |
| InChIKey | XIUWIJVFAADVMS-NFFVHWSESA-N |
| XLogP | 4.85 |
| TPSA | 95.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|