C32H33F4OS+ — CID 157069609
(4-hydroxyphenyl)-diphenylsulfanium;4-(1,1,2,2-tetrafluoroethyl)tetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 157069609) has the molecular formula C32H33F4OS+ and a molecular weight of 541.67 g/mol. Its IUPAC name is (4-hydroxyphenyl)-diphenylsulfanium;4-(1,1,2,2-tetrafluoroethyl)tetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | (4-hydroxyphenyl)-diphenylsulfanium;4-(1,1,2,2-tetrafluoroethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 157069609 |
| Molecular Formula | C32H33F4OS+ |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | (4-hydroxyphenyl)-diphenylsulfanium;4-(1,1,2,2-tetrafluoroethyl)tetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | FC(F)C(F)(F)C1CC2CC1C1C3CCC(C3)C21.Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H14OS.C14H18F4/c19-15-11-13-18(14-12-15)20(16-7-3-1-4-8-16)17-9-5-2-6-10-17;15-13(16)14(17,18)10-5-8-4-9(10)12-7-2-1-6(3-7)11(8)12/h1-14H;6-13H,1-5H2/p+1 |
| InChIKey | ACGRGFPOIWWUTA-UHFFFAOYSA-O |
| XLogP | 8.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|