C30H34F4O4S2 — CID 139974569
[1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 139974569) has the molecular formula C30H34F4O4S2 and a molecular weight of 598.72 g/mol. Its IUPAC name is [1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | [1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 139974569 |
| Molecular Formula | C30H34F4O4S2 |
| Molecular Weight | 598.72 g/mol |
| Exact Mass | 598.18 |
| IUPAC Name | [1-(2-naphthalen-1-yl-2-oxoethyl)thiolan-1-yl] 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | O=C(CS1(OS(=O)(=O)C(F)(F)C(F)(F)C2CC3CC2C2C4CCC(C4)C32)CCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H34F4O4S2/c31-29(32,25-16-21-15-24(25)28-20-11-10-19(14-20)27(21)28)30(33,34)40(36,37)38-39(12-3-4-13-39)17-26(35)23-9-5-7-18-6-1-2-8-22(18)23/h1-2,5-9,19-21,24-25,27-28H,3-4,10-17H2 |
| InChIKey | XOTSNNJJBRSTJX-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.72 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|