C27H25F4OS+ — CID 157337896
6-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-one;triphenylsulfanium (PubChem CID 157337896) has the molecular formula C27H25F4OS+ and a molecular weight of 473.56 g/mol. Its IUPAC name is 6-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-one;triphenylsulfanium.
| Compound Name | 6-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-one;triphenylsulfanium |
|---|---|
| PubChem CID | 157337896 |
| Molecular Formula | C27H25F4OS+ |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 6-(1,1,2,2-tetrafluoroethyl)bicyclo[2.2.1]heptan-2-one;triphenylsulfanium |
| SMILES | O=C1CC2CC1C(C(F)(F)C(F)F)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H10F4O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-8(11)9(12,13)6-2-4-1-5(6)7(14)3-4/h1-15H;4-6,8H,1-3H2/q+1; |
| InChIKey | BGBBREAQQZWNRU-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|