C37H55N3O8 — CID 157070886
[4-[[(2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoyl]amino]-2-(3-propoxypropyl)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 157070886) has the molecular formula C37H55N3O8 and a molecular weight of 669.86 g/mol. Its IUPAC name is [4-[[(2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoyl]amino]-2-(3-propoxypropyl)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-[[(2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoyl]amino]-2-(3-propoxypropyl)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 157070886 |
| Molecular Formula | C37H55N3O8 |
| Molecular Weight | 669.86 g/mol |
| Exact Mass | 669.40 |
| IUPAC Name | [4-[[(2R,5S)-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-2,6-dimethyl-4-oxoheptanoyl]amino]-2-(3-propoxypropyl)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCOCCCc1cc(NC(=O)[C@H](C)CC(=O)[C@@H](NC(=O)CCCCCN2C(=O)C=CC2=O)C(C)C)ccc1COC(=O)C(C)(C)C |
| InChI | InChI=1S/C37H55N3O8/c1-8-20-47-21-12-13-27-23-29(16-15-28(27)24-48-36(46)37(5,6)7)38-35(45)26(4)22-30(41)34(25(2)3)39-31(42)14-10-9-11-19-40-32(43)17-18-33(40)44/h15-18,23,25-26,34H,8-14,19-22,24H2,1-7H3,(H,38,45)(H,39,42)/t26-,34+/m1/s1 |
| InChIKey | NPPABHDJBIDRTK-SFRLIIPVSA-N |
| XLogP | 5.30 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.86 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|