C19H21N3O4S — CID 15708418
3,4-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]sulfonylbenzamide (PubChem CID 15708418) has the molecular formula C19H21N3O4S and a molecular weight of 387.46 g/mol. Its IUPAC name is 3,4-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]sulfonylbenzamide.
| Compound Name | 3,4-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 15708418 |
| Molecular Formula | C19H21N3O4S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 3,4-dimethyl-N-[4-(prop-2-enylcarbamoylamino)phenyl]sulfonylbenzamide |
| SMILES | C=CCNC(=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C19H21N3O4S/c1-4-11-20-19(24)21-16-7-9-17(10-8-16)27(25,26)22-18(23)15-6-5-13(2)14(3)12-15/h4-10,12H,1,11H2,2-3H3,(H,22,23)(H2,20,21,24) |
| InChIKey | FRFUJCQXZASVAC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|