C30H38N2O6 — CID 157086439
N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[2-(1,4-oxazepan-4-yl)ethoxy]phenyl]ethynyl]benzamide;methane (PubChem CID 157086439) has the molecular formula C30H38N2O6 and a molecular weight of 522.64 g/mol. Its IUPAC name is N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[2-(1,4-oxazepan-4-yl)ethoxy]phenyl]ethynyl]benzamide;methane.
| Compound Name | N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[2-(1,4-oxazepan-4-yl)ethoxy]phenyl]ethynyl]benzamide;methane |
|---|---|
| PubChem CID | 157086439 |
| Molecular Formula | C30H38N2O6 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-[2-(1,4-oxazepan-4-yl)ethoxy]phenyl]ethynyl]benzamide;methane |
| SMILES | C.CCC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(C#Cc2ccc(OCCN3CCCOCC3)cc2)cc1 |
| InChI | InChI=1S/C29H34N2O6.CH4/c1-3-26(33)28(27(34)21-32)30(2)29(35)24-11-7-22(8-12-24)5-6-23-9-13-25(14-10-23)37-20-17-31-15-4-18-36-19-16-31;/h7-14,28,32H,3-4,15-21H2,1-2H3;1H4 |
| InChIKey | AEDILDLZRDSGST-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|