C32H46N8O3 — CID 157088065
(2R,5R)-5-amino-N-[(1S)-5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]-8-(diaminomethylideneamino)-2-[(2,6-dimethylphenyl)methyl]-4-oxooctanamide (PubChem CID 157088065) has the molecular formula C32H46N8O3 and a molecular weight of 590.77 g/mol. Its IUPAC name is (2R,5R)-5-amino-N-[(1S)-5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]-8-(diaminomethylideneamino)-2-[(2,6-dimethylphenyl)methyl]-4-oxooctanamide.
| Compound Name | (2R,5R)-5-amino-N-[(1S)-5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]-8-(diaminomethylideneamino)-2-[(2,6-dimethylphenyl)methyl]-4-oxooctanamide |
|---|---|
| PubChem CID | 157088065 |
| Molecular Formula | C32H46N8O3 |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.37 |
| IUPAC Name | (2R,5R)-5-amino-N-[(1S)-5-amino-1-(3-benzyl-1,2,4-oxadiazol-5-yl)pentyl]-8-(diaminomethylideneamino)-2-[(2,6-dimethylphenyl)methyl]-4-oxooctanamide |
| SMILES | Cc1cccc(C)c1C[C@H](CC(=O)[C@H](N)CCCN=C(N)N)C(=O)N[C@@H](CCCCN)c1nc(Cc2ccccc2)no1 |
| InChI | InChI=1S/C32H46N8O3/c1-21-10-8-11-22(2)25(21)19-24(20-28(41)26(34)14-9-17-37-32(35)36)30(42)38-27(15-6-7-16-33)31-39-29(40-43-31)18-23-12-4-3-5-13-23/h3-5,8,10-13,24,26-27H,6-7,9,14-20,33-34H2,1-2H3,(H,38,42)(H4,35,36,37)/t24-,26-,27+/m1/s1 |
| InChIKey | AEIAXDHNISBCLZ-IEUSDUHPSA-N |
| XLogP | 2.76 |
| TPSA | 201.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|