C32H40F12O6 — CID 157092825
6-butan-2-ylnaphthalen-2-ol;2-methyl-2-(trifluoromethyl)butanoic acid;(4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 2-methylbutanoate (PubChem CID 157092825) has the molecular formula C32H40F12O6 and a molecular weight of 748.64 g/mol. Its IUPAC name is 6-butan-2-ylnaphthalen-2-ol;2-methyl-2-(trifluoromethyl)butanoic acid;(4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 2-methylbutanoate.
| Compound Name | 6-butan-2-ylnaphthalen-2-ol;2-methyl-2-(trifluoromethyl)butanoic acid;(4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 157092825 |
| Molecular Formula | C32H40F12O6 |
| Molecular Weight | 748.64 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | 6-butan-2-ylnaphthalen-2-ol;2-methyl-2-(trifluoromethyl)butanoic acid;(4,4,5,5,6,6,7,7,7-nonafluoro-3-hydroxyheptyl) 2-methylbutanoate |
| SMILES | CCC(C)(C(=O)O)C(F)(F)F.CCC(C)C(=O)OCCC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.CCC(C)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C14H16O.C12H15F9O3.C6H9F3O2/c1-3-10(2)11-4-5-13-9-14(15)7-6-12(13)8-11;1-3-6(2)8(23)24-5-4-7(22)9(13,14)10(15,16)11(17,18)12(19,20)21;1-3-5(2,4(10)11)6(7,8)9/h4-10,15H,3H2,1-2H3;6-7,22H,3-5H2,1-2H3;3H2,1-2H3,(H,10,11) |
| InChIKey | AEWBLSJZCKYRLY-UHFFFAOYSA-N |
| XLogP | 9.90 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.64 |
| LogP ≤ 5 | 9.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|