C21H36Pt2-2 — CID 157096140
2,6-dimethylheptane;1,3-di(propan-2-yl)benzene-2-ide;platinum (PubChem CID 157096140) has the molecular formula C21H36Pt2-2 and a molecular weight of 678.67 g/mol. Its IUPAC name is 2,6-dimethylheptane;1,3-di(propan-2-yl)benzene-2-ide;platinum.
| Compound Name | 2,6-dimethylheptane;1,3-di(propan-2-yl)benzene-2-ide;platinum |
|---|---|
| PubChem CID | 157096140 |
| Molecular Formula | C21H36Pt2-2 |
| Molecular Weight | 678.67 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | 2,6-dimethylheptane;1,3-di(propan-2-yl)benzene-2-ide;platinum |
| SMILES | CC(C)C[CH-]CC(C)C.CC(C)c1[c-]c(C(C)C)ccc1.[Pt].[Pt] |
| InChI | InChI=1S/C12H17.C9H19.2Pt/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-8(2)6-5-7-9(3)4;;/h5-7,9-10H,1-4H3;5,8-9H,6-7H2,1-4H3;;/q2*-1;; |
| InChIKey | WPFNDGALTAOXCR-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.67 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|