C18H17ClF3N3O2S — CID 157106749
N-[4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]butanoyl]-6-methyl-2-pyridinyl]acetamide (PubChem CID 157106749) has the molecular formula C18H17ClF3N3O2S and a molecular weight of 431.87 g/mol. Its IUPAC name is N-[4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]butanoyl]-6-methyl-2-pyridinyl]acetamide.
| Compound Name | N-[4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]butanoyl]-6-methyl-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 157106749 |
| Molecular Formula | C18H17ClF3N3O2S |
| Molecular Weight | 431.87 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | N-[4-[4-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]butanoyl]-6-methyl-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(=O)CCCSc2ncc(C(F)(F)F)cc2Cl)cc(C)n1 |
| InChI | InChI=1S/C18H17ClF3N3O2S/c1-10-6-12(7-16(24-10)25-11(2)26)15(27)4-3-5-28-17-14(19)8-13(9-23-17)18(20,21)22/h6-9H,3-5H2,1-2H3,(H,24,25,26) |
| InChIKey | AGJRAXRDNPUCCR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.87 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|