C16H15ClF3N5OS — CID 155416866
N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]acetamide (PubChem CID 155416866) has the molecular formula C16H15ClF3N5OS and a molecular weight of 417.84 g/mol. Its IUPAC name is N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]acetamide.
| Compound Name | N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 155416866 |
| Molecular Formula | C16H15ClF3N5OS |
| Molecular Weight | 417.84 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1cc(/C(N)=N/CCSc2ncc(C(F)(F)F)cc2Cl)ccn1 |
| InChI | InChI=1S/C16H15ClF3N5OS/c1-9(26)25-13-6-10(2-3-22-13)14(21)23-4-5-27-15-12(17)7-11(8-24-15)16(18,19)20/h2-3,6-8H,4-5H2,1H3,(H2,21,23)(H,22,25,26) |
| InChIKey | LDEROKIWNCHHNT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.84 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|