C18H19ClF3N5OS — CID 155416902
N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]-2-methylpropanamide (PubChem CID 155416902) has the molecular formula C18H19ClF3N5OS and a molecular weight of 445.90 g/mol. Its IUPAC name is N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]-2-methylpropanamide.
| Compound Name | N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 155416902 |
| Molecular Formula | C18H19ClF3N5OS |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[4-[N'-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]carbamimidoyl]-2-pyridinyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1cc(/C(N)=N/CCSc2ncc(C(F)(F)F)cc2Cl)ccn1 |
| InChI | InChI=1S/C18H19ClF3N5OS/c1-10(2)16(28)27-14-7-11(3-4-24-14)15(23)25-5-6-29-17-13(19)8-12(9-26-17)18(20,21)22/h3-4,7-10H,5-6H2,1-2H3,(H2,23,25)(H,24,27,28) |
| InChIKey | JDWVRDAFZSXCPN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|