C24H37F3O7 — CID 157108094
tert-butyl 3-[5-methyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-3-(2,2,2-trifluoroacetyl)oxypropanoate;methane (PubChem CID 157108094) has the molecular formula C24H37F3O7 and a molecular weight of 494.55 g/mol. Its IUPAC name is tert-butyl 3-[5-methyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-3-(2,2,2-trifluoroacetyl)oxypropanoate;methane.
| Compound Name | tert-butyl 3-[5-methyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-3-(2,2,2-trifluoroacetyl)oxypropanoate;methane |
|---|---|
| PubChem CID | 157108094 |
| Molecular Formula | C24H37F3O7 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.25 |
| IUPAC Name | tert-butyl 3-[5-methyl-6-(4-methyl-2,5-dioxooxolan-3-yl)-2-bicyclo[2.2.1]heptanyl]-3-(2,2,2-trifluoroacetyl)oxypropanoate;methane |
| SMILES | C.C.CC1C(=O)OC(=O)C1C1C(C)C2CC(C(CC(=O)OC(C)(C)C)OC(=O)C(F)(F)F)C1C2 |
| InChI | InChI=1S/C22H29F3O7.2CH4/c1-9-11-6-12(13(7-11)16(9)17-10(2)18(27)31-19(17)28)14(30-20(29)22(23,24)25)8-15(26)32-21(3,4)5;;/h9-14,16-17H,6-8H2,1-5H3;2*1H4 |
| InChIKey | AGNNCOVPQUZKEA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|