C12H9F17O3 — CID 157108994
3-(fluoromethoxy)prop-1-ene;1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(2,2,2-trifluoroethoxy)propane (PubChem CID 157108994) has the molecular formula C12H9F17O3 and a molecular weight of 524.17 g/mol. Its IUPAC name is 3-(fluoromethoxy)prop-1-ene;1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(2,2,2-trifluoroethoxy)propane.
| Compound Name | 3-(fluoromethoxy)prop-1-ene;1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(2,2,2-trifluoroethoxy)propane |
|---|---|
| PubChem CID | 157108994 |
| Molecular Formula | C12H9F17O3 |
| Molecular Weight | 524.17 g/mol |
| Exact Mass | 524.03 |
| IUPAC Name | 3-(fluoromethoxy)prop-1-ene;1,1,1,2,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)-3-(2,2,2-trifluoroethoxy)propane |
| SMILES | C=CCOCF.FC(F)(F)COC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H2F16O2.C4H7FO/c9-2(10,11)1-25-8(23,24)4(14,6(18,19)20)26-7(21,22)3(12,13)5(15,16)17;1-2-3-6-4-5/h1H2;2H,1,3-4H2 |
| InChIKey | AGPYTOPSWWZOLZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.17 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|