C26H38OS2Sn2 — CID 157114286
[5-[4-(5-dimethylstannylthiophen-2-yl)-2-hexoxy-5-methylphenyl]thiophen-2-yl]-trimethylstannane (PubChem CID 157114286) has the molecular formula C26H38OS2Sn2 and a molecular weight of 668.14 g/mol. Its IUPAC name is [5-[4-(5-dimethylstannylthiophen-2-yl)-2-hexoxy-5-methylphenyl]thiophen-2-yl]-trimethylstannane.
| Compound Name | [5-[4-(5-dimethylstannylthiophen-2-yl)-2-hexoxy-5-methylphenyl]thiophen-2-yl]-trimethylstannane |
|---|---|
| PubChem CID | 157114286 |
| Molecular Formula | C26H38OS2Sn2 |
| Molecular Weight | 668.14 g/mol |
| Exact Mass | 670.04 |
| IUPAC Name | [5-[4-(5-dimethylstannylthiophen-2-yl)-2-hexoxy-5-methylphenyl]thiophen-2-yl]-trimethylstannane |
| SMILES | CCCCCCOc1cc(-c2ccc([SnH](C)C)s2)c(C)cc1-c1ccc([Sn](C)(C)C)s1 |
| InChI | InChI=1S/C21H22OS2.5CH3.2Sn.H/c1-3-4-5-6-11-22-19-15-17(20-9-7-12-23-20)16(2)14-18(19)21-10-8-13-24-21;;;;;;;;/h7-10,14-15H,3-6,11H2,1-2H3;5*1H3;;; |
| InChIKey | YAWXHDQSNOVZOY-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.14 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|