C21H47+ — CID 157119351
2,2-dimethylpropane;2-methyl-2-methylbutane;2,2,5,5-tetramethylhexane (PubChem CID 157119351) has the molecular formula C21H47+ and a molecular weight of 299.61 g/mol. Its IUPAC name is 2,2-dimethylpropane;2-methyl-2-methylbutane;2,2,5,5-tetramethylhexane.
| Compound Name | 2,2-dimethylpropane;2-methyl-2-methylbutane;2,2,5,5-tetramethylhexane |
|---|---|
| PubChem CID | 157119351 |
| Molecular Formula | C21H47+ |
| Molecular Weight | 299.61 g/mol |
| Exact Mass | 299.37 |
| IUPAC Name | 2,2-dimethylpropane;2-methyl-2-methylbutane;2,2,5,5-tetramethylhexane |
| SMILES | CC(C)(C)C.CC(C)(C)CCC(C)(C)C.[CH2+]C(C)(C)CC |
| InChI | InChI=1S/C10H22.C6H13.C5H12/c1-9(2,3)7-8-10(4,5)6;1-5-6(2,3)4;1-5(2,3)4/h7-8H2,1-6H3;2,5H2,1,3-4H3;1-4H3/q;+1; |
| InChIKey | AHUAWLVCYHGDBP-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.61 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|