C28H28N2O2 — CID 157135551
(2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-methyl-3-piperidin-1-ylbut-1-ynyl)-1-benzofuran-3-one (PubChem CID 157135551) has the molecular formula C28H28N2O2 and a molecular weight of 424.54 g/mol. Its IUPAC name is (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-methyl-3-piperidin-1-ylbut-1-ynyl)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-methyl-3-piperidin-1-ylbut-1-ynyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 157135551 |
| Molecular Formula | C28H28N2O2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-methyl-3-piperidin-1-ylbut-1-ynyl)-1-benzofuran-3-one |
| SMILES | Cc1ccc2c(c1C#CC(C)(C)N1CCCCC1)O/C(=C\C1=NCc3ccccc31)C2=O |
| InChI | InChI=1S/C28H28N2O2/c1-19-11-12-23-26(31)25(17-24-22-10-6-5-9-20(22)18-29-24)32-27(23)21(19)13-14-28(2,3)30-15-7-4-8-16-30/h5-6,9-12,17H,4,7-8,15-16,18H2,1-3H3/b25-17- |
| InChIKey | LGRBMZLZPVBJMB-UQQQWYQISA-N |
| XLogP | 5.07 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|