C24H23NO2 — CID 158924615
(2Z)-7-cyclohexyl-2-(3H-isoindol-1-ylmethylidene)-6-methyl-1-benzofuran-3-one (PubChem CID 158924615) has the molecular formula C24H23NO2 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2Z)-7-cyclohexyl-2-(3H-isoindol-1-ylmethylidene)-6-methyl-1-benzofuran-3-one.
| Compound Name | (2Z)-7-cyclohexyl-2-(3H-isoindol-1-ylmethylidene)-6-methyl-1-benzofuran-3-one |
|---|---|
| PubChem CID | 158924615 |
| Molecular Formula | C24H23NO2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2Z)-7-cyclohexyl-2-(3H-isoindol-1-ylmethylidene)-6-methyl-1-benzofuran-3-one |
| SMILES | Cc1ccc2c(c1C1CCCCC1)O/C(=C\C1=NCc3ccccc31)C2=O |
| InChI | InChI=1S/C24H23NO2/c1-15-11-12-19-23(26)21(13-20-18-10-6-5-9-17(18)14-25-20)27-24(19)22(15)16-7-3-2-4-8-16/h5-6,9-13,16H,2-4,7-8,14H2,1H3/b21-13- |
| InChIKey | LFZTYYGTAXKUHZ-BKUYFWCQSA-N |
| XLogP | 5.50 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|