C23H21N3O4 — CID 159688642
(6Z)-6-(3H-isoindol-1-ylmethylidene)-4-(piperazin-1-ylmethyl)furo[3,2-f][1,3]benzodioxol-7-one (PubChem CID 159688642) has the molecular formula C23H21N3O4 and a molecular weight of 403.44 g/mol. Its IUPAC name is (6Z)-6-(3H-isoindol-1-ylmethylidene)-4-(piperazin-1-ylmethyl)furo[3,2-f][1,3]benzodioxol-7-one.
| Compound Name | (6Z)-6-(3H-isoindol-1-ylmethylidene)-4-(piperazin-1-ylmethyl)furo[3,2-f][1,3]benzodioxol-7-one |
|---|---|
| PubChem CID | 159688642 |
| Molecular Formula | C23H21N3O4 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (6Z)-6-(3H-isoindol-1-ylmethylidene)-4-(piperazin-1-ylmethyl)furo[3,2-f][1,3]benzodioxol-7-one |
| SMILES | O=C1/C(=C/C2=NCc3ccccc32)Oc2c1cc1c(c2CN2CCNCC2)OCO1 |
| InChI | InChI=1S/C23H21N3O4/c27-21-16-9-20-23(29-13-28-20)17(12-26-7-5-24-6-8-26)22(16)30-19(21)10-18-15-4-2-1-3-14(15)11-25-18/h1-4,9-10,24H,5-8,11-13H2/b19-10- |
| InChIKey | XFWRITJJIWVCAF-GRSHGNNSSA-N |
| XLogP | 2.28 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|