C25H27N3O2 — CID 162265265
(2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperazin-1-ylpropyl)-1-benzofuran-3-one (PubChem CID 162265265) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperazin-1-ylpropyl)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperazin-1-ylpropyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 162265265 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperazin-1-ylpropyl)-1-benzofuran-3-one |
| SMILES | Cc1ccc2c(c1CCCN1CCNCC1)O/C(=C\C1=NCc3ccccc31)C2=O |
| InChI | InChI=1S/C25H27N3O2/c1-17-8-9-21-24(29)23(15-22-20-6-3-2-5-18(20)16-27-22)30-25(21)19(17)7-4-12-28-13-10-26-11-14-28/h2-3,5-6,8-9,15,26H,4,7,10-14,16H2,1H3/b23-15- |
| InChIKey | NIWDPKZFKUJQHJ-HAHDFKILSA-N |
| XLogP | 3.29 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|