C26H24N2O2 — CID 159412445
(2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperidin-4-ylprop-1-ynyl)-1-benzofuran-3-one (PubChem CID 159412445) has the molecular formula C26H24N2O2 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperidin-4-ylprop-1-ynyl)-1-benzofuran-3-one.
| Compound Name | (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperidin-4-ylprop-1-ynyl)-1-benzofuran-3-one |
|---|---|
| PubChem CID | 159412445 |
| Molecular Formula | C26H24N2O2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (2Z)-2-(3H-isoindol-1-ylmethylidene)-6-methyl-7-(3-piperidin-4-ylprop-1-ynyl)-1-benzofuran-3-one |
| SMILES | Cc1ccc2c(c1C#CCC1CCNCC1)O/C(=C\C1=NCc3ccccc31)C2=O |
| InChI | InChI=1S/C26H24N2O2/c1-17-9-10-22-25(29)24(15-23-21-7-3-2-6-19(21)16-28-23)30-26(22)20(17)8-4-5-18-11-13-27-14-12-18/h2-3,6-7,9-10,15,18,27H,5,11-14,16H2,1H3/b24-15- |
| InChIKey | XHVPAUMZQGPQQY-IWIPYMOSSA-N |
| XLogP | 4.20 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|