C17H22ClF2N3O2 — CID 157143760
2-fluoro-4-[[5-fluoro-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]phenol;methane;hydrochloride (PubChem CID 157143760) has the molecular formula C17H22ClF2N3O2 and a molecular weight of 373.83 g/mol. Its IUPAC name is 2-fluoro-4-[[5-fluoro-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]phenol;methane;hydrochloride.
| Compound Name | 2-fluoro-4-[[5-fluoro-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]phenol;methane;hydrochloride |
|---|---|
| PubChem CID | 157143760 |
| Molecular Formula | C17H22ClF2N3O2 |
| Molecular Weight | 373.83 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 2-fluoro-4-[[5-fluoro-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]phenol;methane;hydrochloride |
| SMILES | C.Cl.Oc1ccc(Nc2ncc(F)c(CCC3CCCO3)n2)cc1F |
| InChI | InChI=1S/C16H17F2N3O2.CH4.ClH/c17-12-8-10(3-6-15(12)22)20-16-19-9-13(18)14(21-16)5-4-11-2-1-7-23-11;;/h3,6,8-9,11,22H,1-2,4-5,7H2,(H,19,20,21);1H4;1H |
| InChIKey | XHMQXEOKYKUFLC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|