C18H25BrClN3O2 — CID 158326308
4-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-methylphenol;methane;hydrochloride (PubChem CID 158326308) has the molecular formula C18H25BrClN3O2 and a molecular weight of 430.77 g/mol. Its IUPAC name is 4-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-methylphenol;methane;hydrochloride.
| Compound Name | 4-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-methylphenol;methane;hydrochloride |
|---|---|
| PubChem CID | 158326308 |
| Molecular Formula | C18H25BrClN3O2 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 4-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-methylphenol;methane;hydrochloride |
| SMILES | C.Cc1cc(Nc2ncc(Br)c(CCC3CCCO3)n2)ccc1O.Cl |
| InChI | InChI=1S/C17H20BrN3O2.CH4.ClH/c1-11-9-12(4-7-16(11)22)20-17-19-10-14(18)15(21-17)6-5-13-3-2-8-23-13;;/h4,7,9-10,13,22H,2-3,5-6,8H2,1H3,(H,19,20,21);1H4;1H |
| InChIKey | HWMXQEKGUHHUJQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|