C17H19BrFN3O — CID 159841974
5-bromo-N-(3-fluoro-4-methylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine (PubChem CID 159841974) has the molecular formula C17H19BrFN3O and a molecular weight of 380.26 g/mol. Its IUPAC name is 5-bromo-N-(3-fluoro-4-methylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine.
| Compound Name | 5-bromo-N-(3-fluoro-4-methylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 159841974 |
| Molecular Formula | C17H19BrFN3O |
| Molecular Weight | 380.26 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 5-bromo-N-(3-fluoro-4-methylphenyl)-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-amine |
| SMILES | Cc1ccc(Nc2ncc(Br)c(CCC3CCCO3)n2)cc1F |
| InChI | InChI=1S/C17H19BrFN3O/c1-11-4-5-12(9-15(11)19)21-17-20-10-14(18)16(22-17)7-6-13-3-2-8-23-13/h4-5,9-10,13H,2-3,6-8H2,1H3,(H,20,21,22) |
| InChIKey | NOUGJDURJXNBBM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |