C17H18BrN3O4 — CID 159927242
5-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid (PubChem CID 159927242) has the molecular formula C17H18BrN3O4 and a molecular weight of 408.25 g/mol. Its IUPAC name is 5-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 159927242 |
| Molecular Formula | C17H18BrN3O4 |
| Molecular Weight | 408.25 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 5-[[5-bromo-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(Nc2ncc(Br)c(CCC3CCCO3)n2)ccc1O |
| InChI | InChI=1S/C17H18BrN3O4/c18-13-9-19-17(21-14(13)5-4-11-2-1-7-25-11)20-10-3-6-15(22)12(8-10)16(23)24/h3,6,8-9,11,22H,1-2,4-5,7H2,(H,23,24)(H,19,20,21) |
| InChIKey | NZEHIDMMCXGMQB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.25 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|