C24H22ClFN4O5 — CID 159816073
5-[[5-[(2-chloro-6-fluorophenyl)carbamoyl]-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid (PubChem CID 159816073) has the molecular formula C24H22ClFN4O5 and a molecular weight of 500.91 g/mol. Its IUPAC name is 5-[[5-[(2-chloro-6-fluorophenyl)carbamoyl]-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[5-[(2-chloro-6-fluorophenyl)carbamoyl]-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 159816073 |
| Molecular Formula | C24H22ClFN4O5 |
| Molecular Weight | 500.91 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 5-[[5-[(2-chloro-6-fluorophenyl)carbamoyl]-4-[2-(oxolan-2-yl)ethyl]pyrimidin-2-yl]amino]-2-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(Nc2ncc(C(=O)Nc3c(F)cccc3Cl)c(CCC3CCCO3)n2)ccc1O |
| InChI | InChI=1S/C24H22ClFN4O5/c25-17-4-1-5-18(26)21(17)30-22(32)16-12-27-24(29-19(16)8-7-14-3-2-10-35-14)28-13-6-9-20(31)15(11-13)23(33)34/h1,4-6,9,11-12,14,31H,2-3,7-8,10H2,(H,30,32)(H,33,34)(H,27,28,29) |
| InChIKey | NLQGGAMKXPDDHZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|