About copper;oxalate;oxocopper
copper;oxalate;oxocopper (PubChem CID 157143920) has the molecular formula C2Cu2O5
and a molecular weight of 231.11 g/mol. Its IUPAC name is copper;oxalate;oxocopper.
Molecular Properties
| Compound Name | copper;oxalate;oxocopper |
| PubChem CID | 157143920 |
| Molecular Formula | C2Cu2O5 |
| Molecular Weight | 231.11 g/mol |
| Exact Mass | 229.83 |
| IUPAC Name | copper;oxalate;oxocopper |
| SMILES | O=C([O-])C(=O)[O-].O=[Cu].[Cu+2] |
| InChI | InChI=1S/C2H2O4.2Cu.O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;;/q;;+2;/p-2 |
| InChIKey | IJROAUFGQSJMNI-UHFFFAOYSA-L |
| XLogP | -3.64 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.11 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze copper;oxalate;oxocopper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;oxalate;oxocopper?
The IUPAC name of copper;oxalate;oxocopper (CID 157143920) is copper;oxalate;oxocopper.
What is the SMILES notation for copper;oxalate;oxocopper?
The canonical SMILES for copper;oxalate;oxocopper is O=C([O-])C(=O)[O-].O=[Cu].[Cu+2].
What is the InChIKey of copper;oxalate;oxocopper?
The InChIKey is IJROAUFGQSJMNI-UHFFFAOYSA-L. The full InChI is InChI=1S/C2H2O4.2Cu.O/c3-1(4)2(5)6;;;/h(H,3,4)(H,5,6);;;/q;;+2;/p-2.
What are the key properties of copper;oxalate;oxocopper?
copper;oxalate;oxocopper has a molecular weight of 231.11 g/mol, XLogP of -3.64, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for copper;oxalate;oxocopper is sourced from PubChem (CID 157143920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).