C24H23NO5S — CID 157149734
5-methyl-2-[2-methyl-4-[(4-propanoylbenzoyl)amino]phenyl]benzenesulfonic acid (PubChem CID 157149734) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 5-methyl-2-[2-methyl-4-[(4-propanoylbenzoyl)amino]phenyl]benzenesulfonic acid.
| Compound Name | 5-methyl-2-[2-methyl-4-[(4-propanoylbenzoyl)amino]phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 157149734 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 5-methyl-2-[2-methyl-4-[(4-propanoylbenzoyl)amino]phenyl]benzenesulfonic acid |
| SMILES | CCC(=O)c1ccc(C(=O)Nc2ccc(-c3ccc(C)cc3S(=O)(=O)O)c(C)c2)cc1 |
| InChI | InChI=1S/C24H23NO5S/c1-4-22(26)17-6-8-18(9-7-17)24(27)25-19-10-12-20(16(3)14-19)21-11-5-15(2)13-23(21)31(28,29)30/h5-14H,4H2,1-3H3,(H,25,27)(H,28,29,30) |
| InChIKey | ALCRHBGKOCYNPO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|