C24H17BrCl2N4O2 — CID 157157508
7-bromo-2-methylindazole-3-carbaldehyde;7-(2,4-dichlorophenyl)-2-methylindazole-3-carbaldehyde (PubChem CID 157157508) has the molecular formula C24H17BrCl2N4O2 and a molecular weight of 544.24 g/mol. Its IUPAC name is 7-bromo-2-methylindazole-3-carbaldehyde;7-(2,4-dichlorophenyl)-2-methylindazole-3-carbaldehyde.
| Compound Name | 7-bromo-2-methylindazole-3-carbaldehyde;7-(2,4-dichlorophenyl)-2-methylindazole-3-carbaldehyde |
|---|---|
| PubChem CID | 157157508 |
| Molecular Formula | C24H17BrCl2N4O2 |
| Molecular Weight | 544.24 g/mol |
| Exact Mass | 541.99 |
| IUPAC Name | 7-bromo-2-methylindazole-3-carbaldehyde;7-(2,4-dichlorophenyl)-2-methylindazole-3-carbaldehyde |
| SMILES | Cn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1C=O.Cn1nc2c(Br)cccc2c1C=O |
| InChI | InChI=1S/C15H10Cl2N2O.C9H7BrN2O/c1-19-14(8-20)12-4-2-3-11(15(12)18-19)10-6-5-9(16)7-13(10)17;1-12-8(5-13)6-3-2-4-7(10)9(6)11-12/h2-8H,1H3;2-5H,1H3 |
| InChIKey | ALZIAYQTZOADGI-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.24 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|