C18H13Cl2N3O2 — CID 91469465
1-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]pyrrole-2,5-diol (PubChem CID 91469465) has the molecular formula C18H13Cl2N3O2 and a molecular weight of 374.23 g/mol. Its IUPAC name is 1-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]pyrrole-2,5-diol.
| Compound Name | 1-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91469465 |
| Molecular Formula | C18H13Cl2N3O2 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 1-[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl]pyrrole-2,5-diol |
| SMILES | Cn1nc2c(-c3ccc(Cl)cc3Cl)cccc2c1-n1c(O)ccc1O |
| InChI | InChI=1S/C18H13Cl2N3O2/c1-22-18(23-15(24)7-8-16(23)25)13-4-2-3-12(17(13)21-22)11-6-5-10(19)9-14(11)20/h2-9,24-25H,1H3 |
| InChIKey | HDSQJWZDIUFYJZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |