C16H12Cl2N2O3 — CID 68614157
[7-(2,4-dichlorophenyl)-2-methylindazol-3-yl] methyl carbonate (PubChem CID 68614157) has the molecular formula C16H12Cl2N2O3 and a molecular weight of 351.19 g/mol. Its IUPAC name is [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl] methyl carbonate.
| Compound Name | [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl] methyl carbonate |
|---|---|
| PubChem CID | 68614157 |
| Molecular Formula | C16H12Cl2N2O3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | [7-(2,4-dichlorophenyl)-2-methylindazol-3-yl] methyl carbonate |
| SMILES | COC(=O)Oc1c2cccc(-c3ccc(Cl)cc3Cl)c2nn1C |
| InChI | InChI=1S/C16H12Cl2N2O3/c1-20-15(23-16(21)22-2)12-5-3-4-11(14(12)19-20)10-7-6-9(17)8-13(10)18/h3-8H,1-2H3 |
| InChIKey | YNFDEAQCCDVRFA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |