C21H26O7 — CID 157173329
7-hydroxy-6-(2-methoxyethoxy)-4-methyl-2-oxo-3-(3-oxoheptyl)chromene-8-carbaldehyde (PubChem CID 157173329) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is 7-hydroxy-6-(2-methoxyethoxy)-4-methyl-2-oxo-3-(3-oxoheptyl)chromene-8-carbaldehyde.
| Compound Name | 7-hydroxy-6-(2-methoxyethoxy)-4-methyl-2-oxo-3-(3-oxoheptyl)chromene-8-carbaldehyde |
|---|---|
| PubChem CID | 157173329 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 7-hydroxy-6-(2-methoxyethoxy)-4-methyl-2-oxo-3-(3-oxoheptyl)chromene-8-carbaldehyde |
| SMILES | CCCCC(=O)CCc1c(C)c2cc(OCCOC)c(O)c(C=O)c2oc1=O |
| InChI | InChI=1S/C21H26O7/c1-4-5-6-14(23)7-8-15-13(2)16-11-18(27-10-9-26-3)19(24)17(12-22)20(16)28-21(15)25/h11-12,24H,4-10H2,1-3H3 |
| InChIKey | CHEANCIAQWUSRG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|