C26H29Cl2N7O5S — CID 157177705
4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide;4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid (PubChem CID 157177705) has the molecular formula C26H29Cl2N7O5S and a molecular weight of 622.54 g/mol. Its IUPAC name is 4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide;4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid.
| Compound Name | 4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide;4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 157177705 |
| Molecular Formula | C26H29Cl2N7O5S |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 4-chloro-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide;4-chloro-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxylic acid |
| SMILES | CS(=O)(=O)CCCNC(=O)C1CCc2[nH]c3ncnc(Cl)c3c2C1.O=C(O)C1CCc2[nH]c3ncnc(Cl)c3c2C1 |
| InChI | InChI=1S/C15H19ClN4O3S.C11H10ClN3O2/c1-24(22,23)6-2-5-17-15(21)9-3-4-11-10(7-9)12-13(16)18-8-19-14(12)20-11;12-9-8-6-3-5(11(16)17)1-2-7(6)15-10(8)14-4-13-9/h8-9H,2-7H2,1H3,(H,17,21)(H,18,19,20);4-5H,1-3H2,(H,16,17)(H,13,14,15) |
| InChIKey | AOFATGGIWHJSOM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|