C23H27N5O3S — CID 118062561
(6S)-4-(2,3-dihydroindol-1-yl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062561) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is (6S)-4-(2,3-dihydroindol-1-yl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-(2,3-dihydroindol-1-yl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062561 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (6S)-4-(2,3-dihydroindol-1-yl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)[C@H]1CCc2[nH]c3ncnc(N4CCc5ccccc54)c3c2C1 |
| InChI | InChI=1S/C23H27N5O3S/c1-32(30,31)12-4-10-24-23(29)16-7-8-18-17(13-16)20-21(27-18)25-14-26-22(20)28-11-9-15-5-2-3-6-19(15)28/h2-3,5-6,14,16H,4,7-13H2,1H3,(H,24,29)(H,25,26,27)/t16-/m0/s1 |
| InChIKey | ZXHCBHXQGSABNZ-INIZCTEOSA-N |
| XLogP | 2.31 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|