C27H24F3N5O — CID 118062038
(6S)-4-(2,3-dihydroindol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062038) has the molecular formula C27H24F3N5O and a molecular weight of 491.52 g/mol. Its IUPAC name is (6S)-4-(2,3-dihydroindol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | (6S)-4-(2,3-dihydroindol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062038 |
| Molecular Formula | C27H24F3N5O |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | (6S)-4-(2,3-dihydroindol-1-yl)-N-[[3-(trifluoromethyl)phenyl]methyl]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | O=C(NCc1cccc(C(F)(F)F)c1)[C@H]1CCc2[nH]c3ncnc(N4CCc5ccccc54)c3c2C1 |
| InChI | InChI=1S/C27H24F3N5O/c28-27(29,30)19-6-3-4-16(12-19)14-31-26(36)18-8-9-21-20(13-18)23-24(34-21)32-15-33-25(23)35-11-10-17-5-1-2-7-22(17)35/h1-7,12,15,18H,8-11,13-14H2,(H,31,36)(H,32,33,34)/t18-/m0/s1 |
| InChIKey | MWPPJDBSZNAKJH-SFHVURJKSA-N |
| XLogP | 5.09 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |