C26H33N7O2 — CID 118987693
N-benzyl-4-[(6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118987693) has the molecular formula C26H33N7O2 and a molecular weight of 475.60 g/mol. Its IUPAC name is N-benzyl-4-[(6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | N-benzyl-4-[(6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118987693 |
| Molecular Formula | C26H33N7O2 |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.27 |
| IUPAC Name | N-benzyl-4-[(6-methoxy-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-5-yl)amino]-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | COC1CC2NNCC2CC1Nc1ncnc2[nH]c3c(c12)CC(C(=O)NCc1ccccc1)CC3 |
| InChI | InChI=1S/C26H33N7O2/c1-35-22-11-20-17(13-30-33-20)10-21(22)32-25-23-18-9-16(7-8-19(18)31-24(23)28-14-29-25)26(34)27-12-15-5-3-2-4-6-15/h2-6,14,16-17,20-22,30,33H,7-13H2,1H3,(H,27,34)(H2,28,29,31,32) |
| InChIKey | FXNBISCYYHJYHD-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |