C22H24N6O3S2 — CID 118062230
4-(1H-indazol-5-ylsulfanyl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide (PubChem CID 118062230) has the molecular formula C22H24N6O3S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is 4-(1H-indazol-5-ylsulfanyl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide.
| Compound Name | 4-(1H-indazol-5-ylsulfanyl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
|---|---|
| PubChem CID | 118062230 |
| Molecular Formula | C22H24N6O3S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 4-(1H-indazol-5-ylsulfanyl)-N-(3-methylsulfonylpropyl)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-b]indole-6-carboxamide |
| SMILES | CS(=O)(=O)CCCNC(=O)C1CCc2[nH]c3ncnc(Sc4ccc5[nH]ncc5c4)c3c2C1 |
| InChI | InChI=1S/C22H24N6O3S2/c1-33(30,31)8-2-7-23-21(29)13-3-5-18-16(10-13)19-20(27-18)24-12-25-22(19)32-15-4-6-17-14(9-15)11-26-28-17/h4,6,9,11-13H,2-3,5,7-8,10H2,1H3,(H,23,29)(H,26,28)(H,24,25,27) |
| InChIKey | LIAMGPOCCKLZDX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|