C28H46B3BrN4O6 — CID 157179524
4-bromopyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 157179524) has the molecular formula C28H46B3BrN4O6 and a molecular weight of 647.04 g/mol. Its IUPAC name is 4-bromopyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | 4-bromopyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 157179524 |
| Molecular Formula | C28H46B3BrN4O6 |
| Molecular Weight | 647.04 g/mol |
| Exact Mass | 646.29 |
| IUPAC Name | 4-bromopyridin-2-amine;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.CC1(C)OB(c2ccnc(N)c2)OC1(C)C.Nc1cc(Br)ccn1 |
| InChI | InChI=1S/C12H24B2O4.C11H17BN2O2.C5H5BrN2/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14;1-10(2)11(3,4)16-12(15-10)8-5-6-14-9(13)7-8;6-4-1-2-8-5(7)3-4/h1-8H3;5-7H,1-4H3,(H2,13,14);1-3H,(H2,7,8) |
| InChIKey | AOKGFWIFOCPRQP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.04 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|