C21H27FeNO4 — CID 157185174
cyclopenta-1,3-diene;iron(2+);methyl (2S)-5-cyclopenta-2,4-dien-1-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 157185174) has the molecular formula C21H27FeNO4 and a molecular weight of 413.30 g/mol. Its IUPAC name is cyclopenta-1,3-diene;iron(2+);methyl (2S)-5-cyclopenta-2,4-dien-1-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
| Compound Name | cyclopenta-1,3-diene;iron(2+);methyl (2S)-5-cyclopenta-2,4-dien-1-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
|---|---|
| PubChem CID | 157185174 |
| Molecular Formula | C21H27FeNO4 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | cyclopenta-1,3-diene;iron(2+);methyl (2S)-5-cyclopenta-2,4-dien-1-yl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | COC(=O)[C@H](CC=C[c-]1cccc1)NC(=O)OC(C)(C)C.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C16H22NO4.C5H5.Fe/c1-16(2,3)21-15(19)17-13(14(18)20-4)11-7-10-12-8-5-6-9-12;1-2-4-5-3-1;/h5-10,13H,11H2,1-4H3,(H,17,19);1-5H;/q2*-1;+2/t13-;;/m0../s1 |
| InChIKey | APAOSGZKVLZCQB-GXKRWWSZSA-N |
| XLogP | 4.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|